C10H10F3NO2 — CID 15653812
2,2,2-trifluoro-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide (PubChem CID 15653812) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 15653812 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide |
| SMILES | O=C(N[C@@H](CO)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2/c11-10(12,13)9(16)14-8(6-15)7-4-2-1-3-5-7/h1-5,8,15H,6H2,(H,14,16)/t8-/m0/s1 |
| InChIKey | YPUDARQIQJYYCH-QMMMGPOBSA-N |
| XLogP | 1.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |