C23H31NO2 — CID 25259507
(2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-2,5,5-trimethyl-2-phenylhexanamide (PubChem CID 25259507) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-2,5,5-trimethyl-2-phenylhexanamide.
| Compound Name | (2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-2,5,5-trimethyl-2-phenylhexanamide |
|---|---|
| PubChem CID | 25259507 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (2R)-N-[(1S)-2-hydroxy-1-phenylethyl]-2,5,5-trimethyl-2-phenylhexanamide |
| SMILES | CC(C)(C)CC[C@@](C)(C(=O)N[C@H](CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-22(2,3)15-16-23(4,19-13-9-6-10-14-19)21(26)24-20(17-25)18-11-7-5-8-12-18/h5-14,20,25H,15-17H2,1-4H3,(H,24,26)/t20-,23-/m1/s1 |
| InChIKey | QVYOGYRPTVNDBF-NFBKMPQASA-N |
| XLogP | 4.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |