C17H17F3N2O — CID 130678853
N-[(1S)-2-(benzylamino)-1-phenylethyl]-2,2,2-trifluoroacetamide (PubChem CID 130678853) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[(1S)-2-(benzylamino)-1-phenylethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S)-2-(benzylamino)-1-phenylethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 130678853 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(1S)-2-(benzylamino)-1-phenylethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(N[C@H](CNCc1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O/c18-17(19,20)16(23)22-15(14-9-5-2-6-10-14)12-21-11-13-7-3-1-4-8-13/h1-10,15,21H,11-12H2,(H,22,23)/t15-/m1/s1 |
| InChIKey | OCCIACAHSDRYSY-OAHLLOKOSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |