C16H18F3NO2 — CID 11695323
2,2,2-trifluoro-N-[(E)-7-oxo-1-phenyloct-3-enyl]acetamide (PubChem CID 11695323) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E)-7-oxo-1-phenyloct-3-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E)-7-oxo-1-phenyloct-3-enyl]acetamide |
|---|---|
| PubChem CID | 11695323 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E)-7-oxo-1-phenyloct-3-enyl]acetamide |
| SMILES | CC(=O)CC/C=C/CC(NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H18F3NO2/c1-12(21)8-4-2-7-11-14(13-9-5-3-6-10-13)20-15(22)16(17,18)19/h2-3,5-7,9-10,14H,4,8,11H2,1H3,(H,20,22)/b7-2+ |
| InChIKey | ASCIDOXSLLZHII-FARCUNLSSA-N |
| XLogP | 3.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|