C11H10F3NO3 — CID 172811542
[(S)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl] acetate (PubChem CID 172811542) has the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. Its IUPAC name is [(S)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl] acetate.
| Compound Name | [(S)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl] acetate |
|---|---|
| PubChem CID | 172811542 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [(S)-phenyl-[(2,2,2-trifluoroacetyl)amino]methyl] acetate |
| SMILES | CC(=O)O[C@H](NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H10F3NO3/c1-7(16)18-9(8-5-3-2-4-6-8)15-10(17)11(12,13)14/h2-6,9H,1H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | SFZHEWVAHFTLLD-VIFPVBQESA-N |
| XLogP | 1.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|