C27H30F3NO2Si — CID 100993402
N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 100993402) has the molecular formula C27H30F3NO2Si and a molecular weight of 485.62 g/mol. Its IUPAC name is N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 100993402 |
| Molecular Formula | C27H30F3NO2Si |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H](NC(=O)C(F)(F)F)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H30F3NO2Si/c1-20(31-25(32)27(28,29)30)24(21-14-8-5-9-15-21)33-34(26(2,3)4,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20,24H,1-4H3,(H,31,32)/t20-,24+/m0/s1 |
| InChIKey | JBSDVJHURQTEKV-GBXCKJPGSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|