C23H26F3NO2 — CID 102123202
2,2,2-trifluoro-N-[(1R,2R)-2-[(3S)-3-methylhex-5-en-3-yl]oxy-1,2-diphenylethyl]acetamide (PubChem CID 102123202) has the molecular formula C23H26F3NO2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2R)-2-[(3S)-3-methylhex-5-en-3-yl]oxy-1,2-diphenylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2R)-2-[(3S)-3-methylhex-5-en-3-yl]oxy-1,2-diphenylethyl]acetamide |
|---|---|
| PubChem CID | 102123202 |
| Molecular Formula | C23H26F3NO2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2R)-2-[(3S)-3-methylhex-5-en-3-yl]oxy-1,2-diphenylethyl]acetamide |
| SMILES | C=CC[C@](C)(CC)O[C@H](c1ccccc1)[C@H](NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C23H26F3NO2/c1-4-16-22(3,5-2)29-20(18-14-10-7-11-15-18)19(17-12-8-6-9-13-17)27-21(28)23(24,25)26/h4,6-15,19-20H,1,5,16H2,2-3H3,(H,27,28)/t19-,20-,22+/m1/s1 |
| InChIKey | SGCLWYGNVMESRW-SJBKTWHCSA-N |
| XLogP | 5.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|