C28H36F3NO5 — CID 11813359
N-[(1R,2R)-1-[(3S)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 11813359) has the molecular formula C28H36F3NO5 and a molecular weight of 523.59 g/mol. Its IUPAC name is N-[(1R,2R)-1-[(3S)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R)-1-[(3S)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11813359 |
| Molecular Formula | C28H36F3NO5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | N-[(1R,2R)-1-[(3S)-1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | COc1c(C)c(C)c(OC)c(CC[C@@](C)(CC=O)O[C@H](c2ccccc2)[C@@H](C)NC(=O)C(F)(F)F)c1C |
| InChI | InChI=1S/C28H36F3NO5/c1-17-18(2)24(36-7)22(19(3)23(17)35-6)13-14-27(5,15-16-33)37-25(21-11-9-8-10-12-21)20(4)32-26(34)28(29,30)31/h8-12,16,20,25H,13-15H2,1-7H3,(H,32,34)/t20-,25+,27+/m1/s1 |
| InChIKey | GSSJTPZTWASDPY-RAHIQWLESA-N |
| XLogP | 5.73 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|