C33H40F3NO4Si — CID 11093220
N-[(1S,2S)-1-[(3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 11093220) has the molecular formula C33H40F3NO4Si and a molecular weight of 599.77 g/mol. Its IUPAC name is N-[(1S,2S)-1-[(3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,2S)-1-[(3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11093220 |
| Molecular Formula | C33H40F3NO4Si |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | N-[(1S,2S)-1-[(3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-oxopentan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H](NC(=O)C(F)(F)F)[C@@H](O[C@@](C)(CC=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H40F3NO4Si/c1-25(37-30(39)33(34,35)36)29(26-15-9-6-10-16-26)41-32(5,21-23-38)22-24-40-42(31(2,3)4,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,23,25,29H,21-22,24H2,1-5H3,(H,37,39)/t25-,29+,32-/m0/s1 |
| InChIKey | JRDITALWZTUXPR-BVKYAAJPSA-N |
| XLogP | 6.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|