C23H35NOSi — CID 66997840
4-[tert-butyl(diphenyl)silyl]oxy-N,2,2-trimethylbutan-1-amine (PubChem CID 66997840) has the molecular formula C23H35NOSi and a molecular weight of 369.62 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-N,2,2-trimethylbutan-1-amine.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-N,2,2-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 66997840 |
| Molecular Formula | C23H35NOSi |
| Molecular Weight | 369.62 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-N,2,2-trimethylbutan-1-amine |
| SMILES | CNCC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H35NOSi/c1-22(2,3)26(20-13-9-7-10-14-20,21-15-11-8-12-16-21)25-18-17-23(4,5)19-24-6/h7-16,24H,17-19H2,1-6H3 |
| InChIKey | GOQHRXWPWSNGAG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|