C27H35NOSi — CID 10811915
N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenylpropan-2-amine (PubChem CID 10811915) has the molecular formula C27H35NOSi and a molecular weight of 417.67 g/mol. Its IUPAC name is N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenylpropan-2-amine.
| Compound Name | N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenylpropan-2-amine |
|---|---|
| PubChem CID | 10811915 |
| Molecular Formula | C27H35NOSi |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-phenylpropan-2-amine |
| SMILES | CC(C)(NCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H35NOSi/c1-26(2,3)30(24-17-11-7-12-18-24,25-19-13-8-14-20-25)29-22-21-28-27(4,5)23-15-9-6-10-16-23/h6-20,28H,21-22H2,1-5H3 |
| InChIKey | NFIFUBPWJUTXNV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|