C24H36O4SSi — CID 150514614
6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexane-2-sulfonic acid (PubChem CID 150514614) has the molecular formula C24H36O4SSi and a molecular weight of 448.70 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexane-2-sulfonic acid.
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexane-2-sulfonic acid |
|---|---|
| PubChem CID | 150514614 |
| Molecular Formula | C24H36O4SSi |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethylhexane-2-sulfonic acid |
| SMILES | CC(CC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C24H36O4SSi/c1-20(29(25,26)27)19-24(5,6)17-18-28-30(23(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20H,17-19H2,1-6H3,(H,25,26,27) |
| InChIKey | IAOIEIXNIKFFIW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|