C30H39NO3Si — CID 11113721
[(1R)-1-phenylethyl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate (PubChem CID 11113721) has the molecular formula C30H39NO3Si and a molecular weight of 489.73 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate.
| Compound Name | [(1R)-1-phenylethyl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 11113721 |
| Molecular Formula | C30H39NO3Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | [(1R)-1-phenylethyl] N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C30H39NO3Si/c1-24(2)31(29(32)34-25(3)26-16-10-7-11-17-26)22-23-33-35(30(4,5)6,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-21,24-25H,22-23H2,1-6H3/t25-/m1/s1 |
| InChIKey | NELZIFPVDIOJFW-RUZDIDTESA-N |
| XLogP | 6.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|