C29H35NO3Si — CID 164898861
1-phenylethyl 1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]aziridine-2-carboxylate (PubChem CID 164898861) has the molecular formula C29H35NO3Si and a molecular weight of 473.69 g/mol. Its IUPAC name is 1-phenylethyl 1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]aziridine-2-carboxylate.
| Compound Name | 1-phenylethyl 1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 164898861 |
| Molecular Formula | C29H35NO3Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 1-phenylethyl 1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]aziridine-2-carboxylate |
| SMILES | CC(OC(=O)C1CN1CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H35NO3Si/c1-23(24-14-8-5-9-15-24)33-28(31)27-22-30(27)20-21-32-34(29(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,23,27H,20-22H2,1-4H3 |
| InChIKey | BXOQHMMQIDTYST-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|