C31H39NO3Si — CID 101000099
tert-butyl (2R)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate (PubChem CID 101000099) has the molecular formula C31H39NO3Si and a molecular weight of 501.74 g/mol. Its IUPAC name is tert-butyl (2R)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101000099 |
| Molecular Formula | C31H39NO3Si |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | tert-butyl (2R)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CN1[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C31H39NO3Si/c1-30(2,3)35-29(33)27-22-32(27)28(24-16-10-7-11-17-24)23-34-36(31(4,5)6,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21,27-28H,22-23H2,1-6H3/t27-,28+,32?/m1/s1 |
| InChIKey | NAZYHVXDIMLQOM-OMUWIBBISA-N |
| XLogP | 5.33 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|