C15H21NO2 — CID 101000098
tert-butyl 1-[(1S)-1-phenylethyl]aziridine-2-carboxylate (PubChem CID 101000098) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is tert-butyl 1-[(1S)-1-phenylethyl]aziridine-2-carboxylate.
| Compound Name | tert-butyl 1-[(1S)-1-phenylethyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101000098 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | tert-butyl 1-[(1S)-1-phenylethyl]aziridine-2-carboxylate |
| SMILES | C[C@@H](c1ccccc1)N1CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO2/c1-11(12-8-6-5-7-9-12)16-10-13(16)14(17)18-15(2,3)4/h5-9,11,13H,10H2,1-4H3/t11-,13?,16?/m0/s1 |
| InChIKey | OXPIFXGIYXYADH-XOMBGVMMSA-N |
| XLogP | 2.77 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|