C30H50N2O3 — CID 164684956
tert-butyl (2R,3S,4R)-2-methyl-1-[(1R)-1-phenylethyl]-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]pyrrolidine-3-carboxylate (PubChem CID 164684956) has the molecular formula C30H50N2O3 and a molecular weight of 486.74 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R)-2-methyl-1-[(1R)-1-phenylethyl]-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R)-2-methyl-1-[(1R)-1-phenylethyl]-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 164684956 |
| Molecular Formula | C30H50N2O3 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.38 |
| IUPAC Name | tert-butyl (2R,3S,4R)-2-methyl-1-[(1R)-1-phenylethyl]-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropan-2-yl]pyrrolidine-3-carboxylate |
| SMILES | C[C@H](c1ccccc1)N1C[C@H](C(C)(C)ON2C(C)(C)CCCC2(C)C)[C@H](C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C30H50N2O3/c1-21(23-16-13-12-14-17-23)31-20-24(25(22(31)2)26(33)34-27(3,4)5)30(10,11)35-32-28(6,7)18-15-19-29(32,8)9/h12-14,16-17,21-22,24-25H,15,18-20H2,1-11H3/t21-,22-,24+,25-/m1/s1 |
| InChIKey | YXSFABSUPDTENY-YQIMAOPZSA-N |
| XLogP | 6.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |