C23H33NO6 — CID 101489171
ditert-butyl 3-hydroxy-3-methyl-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-2,2-dicarboxylate (PubChem CID 101489171) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is ditert-butyl 3-hydroxy-3-methyl-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-2,2-dicarboxylate.
| Compound Name | ditert-butyl 3-hydroxy-3-methyl-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101489171 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | ditert-butyl 3-hydroxy-3-methyl-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-2,2-dicarboxylate |
| SMILES | C[C@H](c1ccccc1)N1C(=O)CC(C)(O)C1(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33NO6/c1-15(16-12-10-9-11-13-16)24-17(25)14-22(8,28)23(24,18(26)29-20(2,3)4)19(27)30-21(5,6)7/h9-13,15,28H,14H2,1-8H3/t15-,22?/m1/s1 |
| InChIKey | ZKEJTTQXCCPSIF-JGHKVMFLSA-N |
| XLogP | 3.15 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|