C28H35NO4 — CID 142700775
tert-butyl 5-oxo-1-[(1R)-1-phenylethyl]-2-(phenylmethoxymethyl)-3-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 142700775) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is tert-butyl 5-oxo-1-[(1R)-1-phenylethyl]-2-(phenylmethoxymethyl)-3-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | tert-butyl 5-oxo-1-[(1R)-1-phenylethyl]-2-(phenylmethoxymethyl)-3-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 142700775 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | tert-butyl 5-oxo-1-[(1R)-1-phenylethyl]-2-(phenylmethoxymethyl)-3-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CCC1(C(=O)OC(C)(C)C)CC(=O)N([C@H](C)c2ccccc2)C1COCc1ccccc1 |
| InChI | InChI=1S/C28H35NO4/c1-6-17-28(26(31)33-27(3,4)5)18-25(30)29(21(2)23-15-11-8-12-16-23)24(28)20-32-19-22-13-9-7-10-14-22/h6-16,21,24H,1,17-20H2,2-5H3/t21-,24?,28?/m1/s1 |
| InChIKey | FXQBYBVKSKSUDK-ILUYOPMWSA-N |
| XLogP | 5.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|