C18H21NO — CID 10869250
(2S)-1-[(1S)-1-phenylethyl]-2-(phenylmethoxymethyl)aziridine (PubChem CID 10869250) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (2S)-1-[(1S)-1-phenylethyl]-2-(phenylmethoxymethyl)aziridine.
| Compound Name | (2S)-1-[(1S)-1-phenylethyl]-2-(phenylmethoxymethyl)aziridine |
|---|---|
| PubChem CID | 10869250 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (2S)-1-[(1S)-1-phenylethyl]-2-(phenylmethoxymethyl)aziridine |
| SMILES | C[C@@H](c1ccccc1)N1C[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C18H21NO/c1-15(17-10-6-3-7-11-17)19-12-18(19)14-20-13-16-8-4-2-5-9-16/h2-11,15,18H,12-14H2,1H3/t15-,18-,19?/m0/s1 |
| InChIKey | GSSBCOPWVHCCJL-SIYBWXAISA-N |
| XLogP | 3.65 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|