C21H27NO2 — CID 138966726
(4R)-4-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]-4-phenylmethoxybutan-1-ol (PubChem CID 138966726) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (4R)-4-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]-4-phenylmethoxybutan-1-ol.
| Compound Name | (4R)-4-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]-4-phenylmethoxybutan-1-ol |
|---|---|
| PubChem CID | 138966726 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (4R)-4-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]-4-phenylmethoxybutan-1-ol |
| SMILES | C[C@H](c1ccccc1)N1C[C@H]1[C@@H](CCCO)OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-17(19-11-6-3-7-12-19)22-15-20(22)21(13-8-14-23)24-16-18-9-4-2-5-10-18/h2-7,9-12,17,20-21,23H,8,13-16H2,1H3/t17-,20+,21-,22?/m1/s1 |
| InChIKey | LPIKCHYLOHGPFT-LLXXINJRSA-N |
| XLogP | 3.79 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|