C26H49NO2Si2 — CID 46845307
tert-butyl-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]butoxy]-dimethylsilane (PubChem CID 46845307) has the molecular formula C26H49NO2Si2 and a molecular weight of 463.86 g/mol. Its IUPAC name is tert-butyl-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 46845307 |
| Molecular Formula | C26H49NO2Si2 |
| Molecular Weight | 463.86 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | tert-butyl-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]butoxy]-dimethylsilane |
| SMILES | C[C@H](c1ccccc1)N1C[C@H]1[C@@H](CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H49NO2Si2/c1-21(22-16-13-12-14-17-22)27-20-23(27)24(29-31(10,11)26(5,6)7)18-15-19-28-30(8,9)25(2,3)4/h12-14,16-17,21,23-24H,15,18-20H2,1-11H3/t21-,23+,24-,27?/m1/s1 |
| InChIKey | YHCXAYAJTVPRPA-OIEXWRJMSA-N |
| XLogP | 7.62 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.86 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|