C18H31NO2Si — CID 135019735
3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(1R)-1-phenylethyl]azetidin-3-ol (PubChem CID 135019735) has the molecular formula C18H31NO2Si and a molecular weight of 321.54 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(1R)-1-phenylethyl]azetidin-3-ol.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(1R)-1-phenylethyl]azetidin-3-ol |
|---|---|
| PubChem CID | 135019735 |
| Molecular Formula | C18H31NO2Si |
| Molecular Weight | 321.54 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[(1R)-1-phenylethyl]azetidin-3-ol |
| SMILES | C[C@H](c1ccccc1)N1CC(O)(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H31NO2Si/c1-15(16-10-8-7-9-11-16)19-12-18(20,13-19)14-21-22(5,6)17(2,3)4/h7-11,15,20H,12-14H2,1-6H3/t15-/m1/s1 |
| InChIKey | CMFRBOUOPVRBOY-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|