C19H31NO3Si — CID 154429024
(3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1-[(1S)-1-phenylethyl]pyrrolidin-2-one (PubChem CID 154429024) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is (3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1-[(1S)-1-phenylethyl]pyrrolidin-2-one.
| Compound Name | (3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1-[(1S)-1-phenylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 154429024 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-1-[(1S)-1-phenylethyl]pyrrolidin-2-one |
| SMILES | C[C@@H](c1ccccc1)N1C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)C1=O |
| InChI | InChI=1S/C19H31NO3Si/c1-14(15-10-8-7-9-11-15)20-12-16(17(21)18(20)22)13-23-24(5,6)19(2,3)4/h7-11,14,16-17,21H,12-13H2,1-6H3/t14-,16-,17-/m0/s1 |
| InChIKey | MWUKZFVZRRXNCQ-XIRDDKMYSA-N |
| XLogP | 3.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|