C19H32O2Si — CID 152761562
trans-(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-ol (PubChem CID 152761562) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is trans-(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-ol.
| Compound Name | trans-(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 152761562 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | trans-(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylcyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCCC(O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H32O2Si/c1-19(2,3)22(4,5)21-14-16-12-9-13-17(20)18(16)15-10-7-6-8-11-15/h6-8,10-11,16-18,20H,9,12-14H2,1-5H3/t16-,17?,18-/m1/s1 |
| InChIKey | GORAFDLFCVGJAL-GVYDCBATSA-N |
| XLogP | 4.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|