C16H26IO2PSi — CID 90087347
cis-(1R,2S)-2-[(tert-butyl-iodophosphanyl-phenylsilyl)oxymethyl]cyclopentan-1-ol (PubChem CID 90087347) has the molecular formula C16H26IO2PSi and a molecular weight of 436.35 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(tert-butyl-iodophosphanyl-phenylsilyl)oxymethyl]cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-2-[(tert-butyl-iodophosphanyl-phenylsilyl)oxymethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 90087347 |
| Molecular Formula | C16H26IO2PSi |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | cis-(1R,2S)-2-[(tert-butyl-iodophosphanyl-phenylsilyl)oxymethyl]cyclopentan-1-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC[C@H]1O)(PI)c1ccccc1 |
| InChI | InChI=1S/C16H26IO2PSi/c1-16(2,3)21(20-17,14-9-5-4-6-10-14)19-12-13-8-7-11-15(13)18/h4-6,9-10,13,15,18,20H,7-8,11-12H2,1-3H3/t13-,15+,21?/m0/s1 |
| InChIKey | FEVMWEFAYSXNMH-YTTLREONSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|