C16H27NOSi — CID 11471425
tert-butyl-dimethyl-[[(2S,3R)-1-methyl-3-phenylaziridin-2-yl]methoxy]silane (PubChem CID 11471425) has the molecular formula C16H27NOSi and a molecular weight of 277.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,3R)-1-methyl-3-phenylaziridin-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,3R)-1-methyl-3-phenylaziridin-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11471425 |
| Molecular Formula | C16H27NOSi |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,3R)-1-methyl-3-phenylaziridin-2-yl]methoxy]silane |
| SMILES | CN1[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H27NOSi/c1-16(2,3)19(5,6)18-12-14-15(17(14)4)13-10-8-7-9-11-13/h7-11,14-15H,12H2,1-6H3/t14-,15-,17?/m1/s1 |
| InChIKey | UQKBMCQQLIJWJR-BLBXNVQISA-N |
| XLogP | 4.06 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|