C19H31NO4Si — CID 101002260
[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylmethoxyaziridin-2-yl]methyl acetate (PubChem CID 101002260) has the molecular formula C19H31NO4Si and a molecular weight of 365.55 g/mol. Its IUPAC name is [(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylmethoxyaziridin-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylmethoxyaziridin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101002260 |
| Molecular Formula | C19H31NO4Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylmethoxyaziridin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)N1OCc1ccccc1 |
| InChI | InChI=1S/C19H31NO4Si/c1-15(21)22-13-17-18(14-24-25(5,6)19(2,3)4)20(17)23-12-16-10-8-7-9-11-16/h7-11,17-18H,12-14H2,1-6H3/t17-,18+,20?/m0/s1 |
| InChIKey | XAWLXGWUJRBNLF-IVAAQHKWSA-N |
| XLogP | 3.76 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|