C27H47NO5Si2 — CID 78324354
[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methyl acetate (PubChem CID 78324354) has the molecular formula C27H47NO5Si2 and a molecular weight of 521.85 g/mol. Its IUPAC name is [(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 78324354 |
| Molecular Formula | C27H47NO5Si2 |
| Molecular Weight | 521.85 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | [(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H47NO5Si2/c1-19(21-16-14-13-15-17-21)28-22(18-31-20(2)29)23(32-34(9,10)26(3,4)5)24(25(28)30)33-35(11,12)27(6,7)8/h13-17,19,22-24H,18H2,1-12H3/t19-,22+,23+,24-/m1/s1 |
| InChIKey | UNCUCUBVVCZDSR-QLBRKBSLSA-N |
| XLogP | 6.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.85 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|