C21H23NO3 — CID 67705047
[2-oxo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-3-yl] 2-methylpropanoate (PubChem CID 67705047) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is [2-oxo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-3-yl] 2-methylpropanoate.
| Compound Name | [2-oxo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 67705047 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [2-oxo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1C(=O)N([C@@H](C)c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c1-14(2)21(24)25-19-18(17-12-8-5-9-13-17)22(20(19)23)15(3)16-10-6-4-7-11-16/h4-15,18-19H,1-3H3/t15-,18?,19?/m0/s1 |
| InChIKey | LUVGDIQDKFGSEZ-MNNVXMFVSA-N |
| XLogP | 3.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |