C25H39NO6Si — CID 23247563
[(2S,3S,6R,7S,8S)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate (PubChem CID 23247563) has the molecular formula C25H39NO6Si and a molecular weight of 477.67 g/mol. Its IUPAC name is [(2S,3S,6R,7S,8S)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate.
| Compound Name | [(2S,3S,6R,7S,8S)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 23247563 |
| Molecular Formula | C25H39NO6Si |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | [(2S,3S,6R,7S,8S)-2-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H](OC(C)=O)C[C@H]2[C@H](OCc3ccccc3)[C@H](O[Si](C)(C)C(C)(C)C)CN21 |
| InChI | InChI=1S/C25H39NO6Si/c1-17(27)29-16-21-22(31-18(2)28)13-20-24(30-15-19-11-9-8-10-12-19)23(14-26(20)21)32-33(6,7)25(3,4)5/h8-12,20-24H,13-16H2,1-7H3/t20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | RKVBGRCPOOSJFX-NLPWIYRPSA-N |
| XLogP | 3.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|