C31H52O9Si2 — CID 10031871
[(2S,3S,5R,6R)-2,6-diacetyloxy-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexyl] acetate (PubChem CID 10031871) has the molecular formula C31H52O9Si2 and a molecular weight of 624.92 g/mol. Its IUPAC name is [(2S,3S,5R,6R)-2,6-diacetyloxy-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexyl] acetate.
| Compound Name | [(2S,3S,5R,6R)-2,6-diacetyloxy-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexyl] acetate |
|---|---|
| PubChem CID | 10031871 |
| Molecular Formula | C31H52O9Si2 |
| Molecular Weight | 624.92 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | [(2S,3S,5R,6R)-2,6-diacetyloxy-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexyl] acetate |
| SMILES | CC(=O)OC1[C@@H](OC(C)=O)[C@H](O[Si](C)(C)C(C)(C)C)C(OCc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H52O9Si2/c1-20(32)36-25-26(37-21(2)33)28(39-41(10,11)30(4,5)6)24(35-19-23-17-15-14-16-18-23)29(27(25)38-22(3)34)40-42(12,13)31(7,8)9/h14-18,24-29H,19H2,1-13H3/t24?,25?,26-,27+,28-,29+ |
| InChIKey | KJKACMZAGOQRDB-PMVYINJXSA-N |
| XLogP | 6.16 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.92 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|