C35H46O6SSi — CID 73293533
[(2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 73293533) has the molecular formula C35H46O6SSi and a molecular weight of 622.90 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 73293533 |
| Molecular Formula | C35H46O6SSi |
| Molecular Weight | 622.90 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C35H46O6SSi/c1-25-18-20-29(21-19-25)42-34-33(40-26(2)36)32(38-23-28-16-12-9-13-17-28)31(37-22-27-14-10-8-11-15-27)30(41-34)24-39-43(6,7)35(3,4)5/h8-21,30-34H,22-24H2,1-7H3/t30-,31-,32+,33+,34-/m1/s1 |
| InChIKey | CAIZZDGQVOUJGC-ZYSDIQSLSA-N |
| XLogP | 7.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.90 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|