C41H50O9SSi — CID 132577885
[(2S,3R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]peroxymethyl]-5-[(4-methoxyphenyl)methylperoxy]-2-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 132577885) has the molecular formula C41H50O9SSi and a molecular weight of 747.00 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]peroxymethyl]-5-[(4-methoxyphenyl)methylperoxy]-2-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]peroxymethyl]-5-[(4-methoxyphenyl)methylperoxy]-2-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 132577885 |
| Molecular Formula | C41H50O9SSi |
| Molecular Weight | 747.00 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]peroxymethyl]-5-[(4-methoxyphenyl)methylperoxy]-2-(4-methylphenyl)sulfanyl-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | COc1ccc(COO[C@H]2[C@H](OCc3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](Sc3ccc(C)cc3)O[C@H]2COO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C41H50O9SSi/c1-29-18-24-34(25-19-29)51-40-38(48-39(42)32-16-12-9-13-17-32)37(44-26-30-14-10-8-11-15-30)36(49-45-27-31-20-22-33(43-5)23-21-31)35(47-40)28-46-50-52(6,7)41(2,3)4/h8-25,35-38,40H,26-28H2,1-7H3/t35-,36+,37-,38+,40-/m0/s1 |
| InChIKey | YOPVMMDBRZASQJ-UFPRBRFUSA-N |
| XLogP | 9.10 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.00 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|