C36H44O8SSi — CID 11365855
[(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-2-phenylsulfanyl-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] benzoate (PubChem CID 11365855) has the molecular formula C36H44O8SSi and a molecular weight of 664.89 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-2-phenylsulfanyl-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-2-phenylsulfanyl-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11365855 |
| Molecular Formula | C36H44O8SSi |
| Molecular Weight | 664.89 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-2-phenylsulfanyl-6-(prop-2-enoxycarbonyloxymethyl)oxan-3-yl] benzoate |
| SMILES | C=CCOC(=O)OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H44O8SSi/c1-7-23-39-35(38)41-25-29-30(40-24-26-17-11-8-12-18-26)31(44-46(5,6)36(2,3)4)32(43-33(37)27-19-13-9-14-20-27)34(42-29)45-28-21-15-10-16-22-28/h7-22,29-32,34H,1,23-25H2,2-6H3/t29-,30-,31+,32-,34+/m1/s1 |
| InChIKey | KABCINUFGZQNDH-PUPFNBACSA-N |
| XLogP | 8.04 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.89 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|