C37H46O8SSi — CID 101236706
[(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(3-oxopentanoyloxymethyl)-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] benzoate (PubChem CID 101236706) has the molecular formula C37H46O8SSi and a molecular weight of 678.92 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(3-oxopentanoyloxymethyl)-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(3-oxopentanoyloxymethyl)-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101236706 |
| Molecular Formula | C37H46O8SSi |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(3-oxopentanoyloxymethyl)-5-phenylmethoxy-2-phenylsulfanyloxan-3-yl] benzoate |
| SMILES | CCC(=O)CC(=O)OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H46O8SSi/c1-7-28(38)23-31(39)41-25-30-32(42-24-26-17-11-8-12-18-26)33(45-47(5,6)37(2,3)4)34(44-35(40)27-19-13-9-14-20-27)36(43-30)46-29-21-15-10-16-22-29/h8-22,30,32-34,36H,7,23-25H2,1-6H3/t30-,32-,33+,34-,36+/m1/s1 |
| InChIKey | ZHIFRPMWNWGBRH-BDOIURIFSA-N |
| XLogP | 7.62 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|