C50H54O5SSi — CID 72736639
tert-butyl-[[(2R,3S,4S,5S,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-diphenylsilane (PubChem CID 72736639) has the molecular formula C50H54O5SSi and a molecular weight of 795.13 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,4S,5S,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3S,4S,5S,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 72736639 |
| Molecular Formula | C50H54O5SSi |
| Molecular Weight | 795.13 g/mol |
| Exact Mass | 794.35 |
| IUPAC Name | tert-butyl-[[(2R,3S,4S,5S,6S)-6-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-diphenylsilane |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C50H54O5SSi/c1-38-30-32-42(33-31-38)56-49-48(53-36-41-24-14-7-15-25-41)47(52-35-40-22-12-6-13-23-40)46(51-34-39-20-10-5-11-21-39)45(55-49)37-54-57(50(2,3)4,43-26-16-8-17-27-43)44-28-18-9-19-29-44/h5-33,45-49H,34-37H2,1-4H3/t45-,46+,47+,48+,49+/m1/s1 |
| InChIKey | DMEJLIPFNSZZSM-HDRSIGIJSA-N |
| XLogP | 10.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.13 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|