C26H37FO5Si — CID 101128901
[(2R,3R,4R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4,5-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 101128901) has the molecular formula C26H37FO5Si and a molecular weight of 476.66 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4,5-bis(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 101128901 |
| Molecular Formula | C26H37FO5Si |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](F)O[C@@H]1CO |
| InChI | InChI=1S/C26H37FO5Si/c1-26(2,3)33(4,5)32-22-21(16-28)31-25(27)24(30-18-20-14-10-7-11-15-20)23(22)29-17-19-12-8-6-9-13-19/h6-15,21-25,28H,16-18H2,1-5H3/t21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | PCXPIEHUQFWYBT-NHTNDUFYSA-N |
| XLogP | 5.23 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|