C22H28O9 — CID 71499927
[(1S,2R,3S,4R,5S)-2,3,4-triacetyloxy-5-phenylmethoxycyclohexyl]methyl acetate (PubChem CID 71499927) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5S)-2,3,4-triacetyloxy-5-phenylmethoxycyclohexyl]methyl acetate.
| Compound Name | [(1S,2R,3S,4R,5S)-2,3,4-triacetyloxy-5-phenylmethoxycyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 71499927 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [(1S,2R,3S,4R,5S)-2,3,4-triacetyloxy-5-phenylmethoxycyclohexyl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@H](OCc2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28O9/c1-13(23)27-12-18-10-19(28-11-17-8-6-5-7-9-17)21(30-15(3)25)22(31-16(4)26)20(18)29-14(2)24/h5-9,18-22H,10-12H2,1-4H3/t18-,19-,20+,21+,22-/m0/s1 |
| InChIKey | XVIWXESBHTURID-ITBHCLRTSA-N |
| XLogP | 1.95 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|