C16H18O6 — CID 91930485
[(5R)-2-hydroxy-3,4-dioxo-5-phenylmethoxycyclohexyl]methyl acetate (PubChem CID 91930485) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is [(5R)-2-hydroxy-3,4-dioxo-5-phenylmethoxycyclohexyl]methyl acetate.
| Compound Name | [(5R)-2-hydroxy-3,4-dioxo-5-phenylmethoxycyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 91930485 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [(5R)-2-hydroxy-3,4-dioxo-5-phenylmethoxycyclohexyl]methyl acetate |
| SMILES | CC(=O)OCC1C[C@@H](OCc2ccccc2)C(=O)C(=O)C1O |
| InChI | InChI=1S/C16H18O6/c1-10(17)21-9-12-7-13(15(19)16(20)14(12)18)22-8-11-5-3-2-4-6-11/h2-6,12-14,18H,7-9H2,1H3/t12?,13-,14?/m1/s1 |
| InChIKey | LYOKDIHJUORTJT-ROKHWSDSSA-N |
| XLogP | 0.65 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|