C15H18O4 — CID 11129110
[(1S,2S,3R,5S)-2-phenylmethoxy-6-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate (PubChem CID 11129110) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is [(1S,2S,3R,5S)-2-phenylmethoxy-6-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate.
| Compound Name | [(1S,2S,3R,5S)-2-phenylmethoxy-6-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 11129110 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [(1S,2S,3R,5S)-2-phenylmethoxy-6-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H]2O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C15H18O4/c1-10(16)17-9-12-7-13-15(19-13)14(12)18-8-11-5-3-2-4-6-11/h2-6,12-15H,7-9H2,1H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | DMUZKFYGBQEUDL-QPSCCSFWSA-N |
| XLogP | 1.92 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|