C26H47NO5Si2 — CID 123486303
2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypyrrolidine-1-carboxylic acid (PubChem CID 123486303) has the molecular formula C26H47NO5Si2 and a molecular weight of 509.84 g/mol. Its IUPAC name is 2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypyrrolidine-1-carboxylic acid.
| Compound Name | 2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123486303 |
| Molecular Formula | C26H47NO5Si2 |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 2,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC(OCc2ccccc2)C(CO[Si](C)(C)C(C)(C)C)N1C(=O)O |
| InChI | InChI=1S/C26H47NO5Si2/c1-25(2,3)33(7,8)31-18-21-16-23(30-17-20-14-12-11-13-15-20)22(27(21)24(28)29)19-32-34(9,10)26(4,5)6/h11-15,21-23H,16-19H2,1-10H3,(H,28,29) |
| InChIKey | JPHFYDSVAKDPIQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|