C30H40O4Si — CID 11237227
(1S,3R,3aS,7S,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-bis(phenylmethoxy)-1,2,3,3a,7,7a-hexahydroinden-4-one (PubChem CID 11237227) has the molecular formula C30H40O4Si and a molecular weight of 492.73 g/mol. Its IUPAC name is (1S,3R,3aS,7S,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-bis(phenylmethoxy)-1,2,3,3a,7,7a-hexahydroinden-4-one.
| Compound Name | (1S,3R,3aS,7S,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-bis(phenylmethoxy)-1,2,3,3a,7,7a-hexahydroinden-4-one |
|---|---|
| PubChem CID | 11237227 |
| Molecular Formula | C30H40O4Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (1S,3R,3aS,7S,7aR)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-bis(phenylmethoxy)-1,2,3,3a,7,7a-hexahydroinden-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C=CC(=O)[C@H]2[C@@H]1[C@@H](OCc1ccccc1)C[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C30H40O4Si/c1-30(2,3)35(4,5)34-21-24-16-17-25(31)29-27(33-20-23-14-10-7-11-15-23)18-26(28(24)29)32-19-22-12-8-6-9-13-22/h6-17,24,26-29H,18-21H2,1-5H3/t24-,26+,27-,28+,29-/m1/s1 |
| InChIKey | SHNADPPSFZXZJP-YJWDFKAOSA-N |
| XLogP | 6.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|