C21H35NO5Si — CID 10024507
(5R,6S)-6-[(1S,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxypropyl]-5-phenylmethoxypiperidin-2-one (PubChem CID 10024507) has the molecular formula C21H35NO5Si and a molecular weight of 409.60 g/mol. Its IUPAC name is (5R,6S)-6-[(1S,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxypropyl]-5-phenylmethoxypiperidin-2-one.
| Compound Name | (5R,6S)-6-[(1S,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxypropyl]-5-phenylmethoxypiperidin-2-one |
|---|---|
| PubChem CID | 10024507 |
| Molecular Formula | C21H35NO5Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (5R,6S)-6-[(1S,2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxypropyl]-5-phenylmethoxypiperidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1NC(=O)CC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H35NO5Si/c1-21(2,3)28(4,5)27-14-16(23)20(25)19-17(11-12-18(24)22-19)26-13-15-9-7-6-8-10-15/h6-10,16-17,19-20,23,25H,11-14H2,1-5H3,(H,22,24)/t16-,17-,19-,20-/m1/s1 |
| InChIKey | UKLQFSLHTGVAOW-HNBVOPMISA-N |
| XLogP | 2.59 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|