C31H57NO4Si2 — CID 11114448
(5S)-5-[(2S,3R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-phenylmethoxyheptan-3-yl]pyrrolidin-2-one (PubChem CID 11114448) has the molecular formula C31H57NO4Si2 and a molecular weight of 563.97 g/mol. Its IUPAC name is (5S)-5-[(2S,3R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-phenylmethoxyheptan-3-yl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(2S,3R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-phenylmethoxyheptan-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11114448 |
| Molecular Formula | C31H57NO4Si2 |
| Molecular Weight | 563.97 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | (5S)-5-[(2S,3R,4R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-7-phenylmethoxyheptan-3-yl]pyrrolidin-2-one |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]([C@@H]1CCC(=O)N1)[C@@H](CCCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H57NO4Si2/c1-24(22-35-37(8,9)30(2,3)4)29(26-19-20-28(33)32-26)27(36-38(10,11)31(5,6)7)18-15-21-34-23-25-16-13-12-14-17-25/h12-14,16-17,24,26-27,29H,15,18-23H2,1-11H3,(H,32,33)/t24-,26+,27-,29-/m1/s1 |
| InChIKey | LOHKCWJUVDGLFO-SQCBCDKRSA-N |
| XLogP | 7.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.97 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|