C29H46O4SSi — CID 11027712
[(2S,6S)-5-(benzenesulfonyl)-2,6-dimethyl-8-phenylmethoxyoctoxy]-tert-butyl-dimethylsilane (PubChem CID 11027712) has the molecular formula C29H46O4SSi and a molecular weight of 518.84 g/mol. Its IUPAC name is [(2S,6S)-5-(benzenesulfonyl)-2,6-dimethyl-8-phenylmethoxyoctoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S,6S)-5-(benzenesulfonyl)-2,6-dimethyl-8-phenylmethoxyoctoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11027712 |
| Molecular Formula | C29H46O4SSi |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | [(2S,6S)-5-(benzenesulfonyl)-2,6-dimethyl-8-phenylmethoxyoctoxy]-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](CCC([C@@H](C)CCOCc1ccccc1)S(=O)(=O)c1ccccc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H46O4SSi/c1-24(22-33-35(6,7)29(3,4)5)18-19-28(34(30,31)27-16-12-9-13-17-27)25(2)20-21-32-23-26-14-10-8-11-15-26/h8-17,24-25,28H,18-23H2,1-7H3/t24-,25-,28?/m0/s1 |
| InChIKey | MSGPWPMDKHHCSY-AMWOSJAMSA-N |
| XLogP | 7.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|