C37H74O4Si3 — CID 101029089
[(1R,3R,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dimethyl-1-(2-phenylmethoxyethyl)pentoxy]-tri(propan-2-yl)silane (PubChem CID 101029089) has the molecular formula C37H74O4Si3 and a molecular weight of 667.25 g/mol. Its IUPAC name is [(1R,3R,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dimethyl-1-(2-phenylmethoxyethyl)pentoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1R,3R,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dimethyl-1-(2-phenylmethoxyethyl)pentoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101029089 |
| Molecular Formula | C37H74O4Si3 |
| Molecular Weight | 667.25 g/mol |
| Exact Mass | 666.49 |
| IUPAC Name | [(1R,3R,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dimethyl-1-(2-phenylmethoxyethyl)pentoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@H](CCOCc1ccccc1)C[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H74O4Si3/c1-29(2)44(30(3)4,31(5)6)40-34(24-25-38-28-33-22-20-19-21-23-33)26-37(14,41-43(17,18)36(11,12)13)32(7)27-39-42(15,16)35(8,9)10/h19-23,29-32,34H,24-28H2,1-18H3/t32-,34+,37+/m0/s1 |
| InChIKey | PFAHAKWMVALDOO-XNLCPIGASA-N |
| XLogP | 11.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.25 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|