C33H48O5Si — CID 134978275
[(4R,5R)-5-[(5S)-5,7-bis(phenylmethoxy)hept-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134978275) has the molecular formula C33H48O5Si and a molecular weight of 552.83 g/mol. Its IUPAC name is [(4R,5R)-5-[(5S)-5,7-bis(phenylmethoxy)hept-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,5R)-5-[(5S)-5,7-bis(phenylmethoxy)hept-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134978275 |
| Molecular Formula | C33H48O5Si |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | [(4R,5R)-5-[(5S)-5,7-bis(phenylmethoxy)hept-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H](CC#CC[C@@H](CCOCc2ccccc2)OCc2ccccc2)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C33H48O5Si/c1-32(2,3)39(6,7)36-26-31-30(37-33(4,5)38-31)21-15-14-20-29(35-25-28-18-12-9-13-19-28)22-23-34-24-27-16-10-8-11-17-27/h8-13,16-19,29-31H,20-26H2,1-7H3/t29-,30+,31+/m0/s1 |
| InChIKey | JMISJAACCJCDNP-OJDZSJEKSA-N |
| XLogP | 7.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|