C21H34N2O4Si — CID 10501525
(2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetonitrile (PubChem CID 10501525) has the molecular formula C21H34N2O4Si and a molecular weight of 406.60 g/mol. Its IUPAC name is (2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetonitrile.
| Compound Name | (2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 10501525 |
| Molecular Formula | C21H34N2O4Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (2R)-2-[benzyl(hydroxy)amino]-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetonitrile |
| SMILES | CC1(C)O[C@@H]([C@@H](C#N)N(O)Cc2ccccc2)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H34N2O4Si/c1-20(2,3)28(6,7)25-15-18-19(27-21(4,5)26-18)17(13-22)23(24)14-16-11-9-8-10-12-16/h8-12,17-19,24H,14-15H2,1-7H3/t17-,18+,19+/m1/s1 |
| InChIKey | JLLLHQUCIXOSSW-QYZOEREBSA-N |
| XLogP | 4.31 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|