C20H31F3O6SSi — CID 10983727
[(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate (PubChem CID 10983727) has the molecular formula C20H31F3O6SSi and a molecular weight of 484.61 g/mol. Its IUPAC name is [(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10983727 |
| Molecular Formula | C20H31F3O6SSi |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [(4R,5S)-5-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]([C@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)[C@@H](COS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C20H31F3O6SSi/c1-18(2,3)31(6,7)29-16(14-11-9-8-10-12-14)17-15(27-19(4,5)28-17)13-26-30(24,25)20(21,22)23/h8-12,15-17H,13H2,1-7H3/t15-,16-,17+/m1/s1 |
| InChIKey | HMQCEXKXLQVEEH-ZACQAIPSSA-N |
| XLogP | 5.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|